About 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine
1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine (PubChem CID 602208) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine.
Molecular Properties
| Compound Name | 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine |
| PubChem CID | 602208 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine |
| SMILES | CC12CN3CCN(CC(C3)C1N)C2 |
| InChI | InChI=1S/C10H19N3/c1-10-6-12-2-3-13(7-10)5-8(4-12)9(10)11/h8-9H,2-7,11H2,1H3 |
| InChIKey | PRTQLXHGKMWUIY-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine?
The IUPAC name of 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine (CID 602208) is 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine.
What is the SMILES notation for 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine?
The canonical SMILES for 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine is CC12CN3CCN(CC(C3)C1N)C2.
What is the InChIKey of 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine?
The InChIKey is PRTQLXHGKMWUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-10-6-12-2-3-13(7-10)5-8(4-12)9(10)11/h8-9H,2-7,11H2,1H3.
What are the key properties of 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine?
1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine has a molecular weight of 181.28 g/mol, XLogP of -0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine is sourced from PubChem (CID 602208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).