C10H14F3NO2 — CID 6022822
(E)-4-(2,6-dimethylmorpholin-4-yl)-1,1,1-trifluorobut-3-en-2-one (PubChem CID 6022822) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is (E)-4-(2,6-dimethylmorpholin-4-yl)-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | (E)-4-(2,6-dimethylmorpholin-4-yl)-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 6022822 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (E)-4-(2,6-dimethylmorpholin-4-yl)-1,1,1-trifluorobut-3-en-2-one |
| SMILES | CC1CN(/C=C/C(=O)C(F)(F)F)CC(C)O1 |
| InChI | InChI=1S/C10H14F3NO2/c1-7-5-14(6-8(2)16-7)4-3-9(15)10(11,12)13/h3-4,7-8H,5-6H2,1-2H3/b4-3+ |
| InChIKey | DVMRBQDLPRTVAL-ONEGZZNKSA-N |
| XLogP | 1.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|