C4H2F3N3O2 — CID 602290
6-(trifluoromethyl)-2H-1,2,4-triazine-3,5-dione (PubChem CID 602290) has the molecular formula C4H2F3N3O2 and a molecular weight of 181.07 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(trifluoromethyl)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 602290 |
| Molecular Formula | C4H2F3N3O2 |
| Molecular Weight | 181.07 g/mol |
| Exact Mass | 181.01 |
| IUPAC Name | 6-(trifluoromethyl)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C4H2F3N3O2/c5-4(6,7)1-2(11)8-3(12)10-9-1/h(H2,8,10,11,12) |
| InChIKey | AJDNGVATLBEZTH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.07 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |