C12H13ClN6O — CID 602331
3-(4-chlorophenyl)-1,7-dimethyl-3,4-dihydro-2H-[1,2,4]triazino[4,3-b][1,2,4,5]tetrazin-6-one (PubChem CID 602331) has the molecular formula C12H13ClN6O and a molecular weight of 292.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,7-dimethyl-3,4-dihydro-2H-[1,2,4]triazino[4,3-b][1,2,4,5]tetrazin-6-one.
| Compound Name | 3-(4-chlorophenyl)-1,7-dimethyl-3,4-dihydro-2H-[1,2,4]triazino[4,3-b][1,2,4,5]tetrazin-6-one |
|---|---|
| PubChem CID | 602331 |
| Molecular Formula | C12H13ClN6O |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-(4-chlorophenyl)-1,7-dimethyl-3,4-dihydro-2H-[1,2,4]triazino[4,3-b][1,2,4,5]tetrazin-6-one |
| SMILES | Cc1nnc2n(c1=O)NC(c1ccc(Cl)cc1)NN2C |
| InChI | InChI=1S/C12H13ClN6O/c1-7-11(20)19-12(15-14-7)18(2)16-10(17-19)8-3-5-9(13)6-4-8/h3-6,10,16-17H,1-2H3 |
| InChIKey | GEWXZAVXQKWDHE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |