C29H24Cl2N2O4 — CID 6023866
(4E)-5-(2,4-dichlorophenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione (PubChem CID 6023866) has the molecular formula C29H24Cl2N2O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is (4E)-5-(2,4-dichlorophenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(2,4-dichlorophenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6023866 |
| Molecular Formula | C29H24Cl2N2O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | (4E)-5-(2,4-dichlorophenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(CCc3c[nH]c4ccccc34)C2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C29H24Cl2N2O4/c1-2-37-20-10-7-17(8-11-20)27(34)25-26(22-12-9-19(30)15-23(22)31)33(29(36)28(25)35)14-13-18-16-32-24-6-4-3-5-21(18)24/h3-12,15-16,26,32,34H,2,13-14H2,1H3/b27-25+ |
| InChIKey | HILUIEGHOOAOMG-IMVLJIQESA-N |
| XLogP | 6.54 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|