C21H30N4O — CID 6024026
4-tert-butyl-N-[(Z)-(1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide (PubChem CID 6024026) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-tert-butyl-N-[(Z)-(1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide.
| Compound Name | 4-tert-butyl-N-[(Z)-(1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 6024026 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-tert-butyl-N-[(Z)-(1-methyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide |
| SMILES | CC12CN3CCN(CC(C3)/C1=N/NC(=O)c1ccc(C(C)(C)C)cc1)C2 |
| InChI | InChI=1S/C21H30N4O/c1-20(2,3)17-7-5-15(6-8-17)19(26)23-22-18-16-11-24-9-10-25(12-16)14-21(18,4)13-24/h5-8,16H,9-14H2,1-4H3,(H,23,26)/b22-18- |
| InChIKey | HRDOAOLZTBNDBC-PYCFMQQDSA-N |
| XLogP | 2.34 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|