About 9H-xanthen-9-amine
9H-xanthen-9-amine (PubChem CID 602451) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 9H-xanthen-9-amine.
Molecular Properties
| Compound Name | 9H-xanthen-9-amine |
| PubChem CID | 602451 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 9H-xanthen-9-amine |
| SMILES | NC1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C13H11NO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13H,14H2 |
| InChIKey | OTTYHRLXKGOXLY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-xanthen-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-xanthen-9-amine?
The IUPAC name of 9H-xanthen-9-amine (CID 602451) is 9H-xanthen-9-amine.
What is the SMILES notation for 9H-xanthen-9-amine?
The canonical SMILES for 9H-xanthen-9-amine is NC1c2ccccc2Oc2ccccc21.
What is the InChIKey of 9H-xanthen-9-amine?
The InChIKey is OTTYHRLXKGOXLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13H,14H2.
What are the key properties of 9H-xanthen-9-amine?
9H-xanthen-9-amine has a molecular weight of 197.24 g/mol, XLogP of 2.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-xanthen-9-amine is sourced from PubChem (CID 602451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).