C16H6F10N2O2 — CID 602476
N,N'-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]ethane-1,2-diimine (PubChem CID 602476) has the molecular formula C16H6F10N2O2 and a molecular weight of 448.22 g/mol. Its IUPAC name is N,N'-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]ethane-1,2-diimine.
| Compound Name | N,N'-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]ethane-1,2-diimine |
|---|---|
| PubChem CID | 602476 |
| Molecular Formula | C16H6F10N2O2 |
| Molecular Weight | 448.22 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | N,N'-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]ethane-1,2-diimine |
| SMILES | Fc1c(F)c(F)c(CON=CC=NOCc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C16H6F10N2O2/c17-7-5(8(18)12(22)15(25)11(7)21)3-29-27-1-2-28-30-4-6-9(19)13(23)16(26)14(24)10(6)20/h1-2H,3-4H2 |
| InChIKey | VNVBOBJSRGZDCW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|