About 2,4-ditert-butylthiophene
2,4-ditert-butylthiophene (PubChem CID 602490) has the molecular formula C12H20S
and a molecular weight of 196.36 g/mol. Its IUPAC name is 2,4-ditert-butylthiophene.
Molecular Properties
| Compound Name | 2,4-ditert-butylthiophene |
| PubChem CID | 602490 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2,4-ditert-butylthiophene |
| SMILES | CC(C)(C)c1csc(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H20S/c1-11(2,3)9-7-10(13-8-9)12(4,5)6/h7-8H,1-6H3 |
| InChIKey | UAEOZSDBIPKLPV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-ditert-butylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butylthiophene?
The IUPAC name of 2,4-ditert-butylthiophene (CID 602490) is 2,4-ditert-butylthiophene.
What is the SMILES notation for 2,4-ditert-butylthiophene?
The canonical SMILES for 2,4-ditert-butylthiophene is CC(C)(C)c1csc(C(C)(C)C)c1.
What is the InChIKey of 2,4-ditert-butylthiophene?
The InChIKey is UAEOZSDBIPKLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20S/c1-11(2,3)9-7-10(13-8-9)12(4,5)6/h7-8H,1-6H3.
What are the key properties of 2,4-ditert-butylthiophene?
2,4-ditert-butylthiophene has a molecular weight of 196.36 g/mol, XLogP of 4.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butylthiophene is sourced from PubChem (CID 602490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).