About 1,2-diphenylethenylbenzene
1,2-diphenylethenylbenzene (PubChem CID 6025) has the molecular formula C20H16
and a molecular weight of 256.35 g/mol. Its IUPAC name is 1,2-diphenylethenylbenzene.
Molecular Properties
| Compound Name | 1,2-diphenylethenylbenzene |
| PubChem CID | 6025 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1,2-diphenylethenylbenzene |
| SMILES | C(=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H |
| InChIKey | MKYQPGPNVYRMHI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diphenylethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylethenylbenzene?
The IUPAC name of 1,2-diphenylethenylbenzene (CID 6025) is 1,2-diphenylethenylbenzene.
What is the SMILES notation for 1,2-diphenylethenylbenzene?
The canonical SMILES for 1,2-diphenylethenylbenzene is C(=C(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 1,2-diphenylethenylbenzene?
The InChIKey is MKYQPGPNVYRMHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H.
What are the key properties of 1,2-diphenylethenylbenzene?
1,2-diphenylethenylbenzene has a molecular weight of 256.35 g/mol, XLogP of 5.28, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylethenylbenzene is sourced from PubChem (CID 6025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).