About 4-phenylbenzamide
4-phenylbenzamide (PubChem CID 602506) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-phenylbenzamide.
Molecular Properties
| Compound Name | 4-phenylbenzamide |
| PubChem CID | 602506 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-phenylbenzamide |
| SMILES | NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H11NO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H2,14,15) |
| InChIKey | LUQVCHRDAGWYMG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbenzamide?
The IUPAC name of 4-phenylbenzamide (CID 602506) is 4-phenylbenzamide.
What is the SMILES notation for 4-phenylbenzamide?
The canonical SMILES for 4-phenylbenzamide is NC(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-phenylbenzamide?
The InChIKey is LUQVCHRDAGWYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H2,14,15).
What are the key properties of 4-phenylbenzamide?
4-phenylbenzamide has a molecular weight of 197.24 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbenzamide is sourced from PubChem (CID 602506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).