C12H12F5NO — CID 602561
N-[(2,3,4,5,6-pentafluorophenyl)methoxy]pentan-1-imine (PubChem CID 602561) has the molecular formula C12H12F5NO and a molecular weight of 281.22 g/mol. Its IUPAC name is N-[(2,3,4,5,6-pentafluorophenyl)methoxy]pentan-1-imine.
| Compound Name | N-[(2,3,4,5,6-pentafluorophenyl)methoxy]pentan-1-imine |
|---|---|
| PubChem CID | 602561 |
| Molecular Formula | C12H12F5NO |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[(2,3,4,5,6-pentafluorophenyl)methoxy]pentan-1-imine |
| SMILES | CCCCC=NOCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5NO/c1-2-3-4-5-18-19-6-7-8(13)10(15)12(17)11(16)9(7)14/h5H,2-4,6H2,1H3 |
| InChIKey | CQVUQQBKUBLHIZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|