C10H8F5NO — CID 602576
N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propan-2-imine (PubChem CID 602576) has the molecular formula C10H8F5NO and a molecular weight of 253.17 g/mol. Its IUPAC name is N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propan-2-imine.
| Compound Name | N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propan-2-imine |
|---|---|
| PubChem CID | 602576 |
| Molecular Formula | C10H8F5NO |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propan-2-imine |
| SMILES | CC(C)=NOCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H8F5NO/c1-4(2)16-17-3-5-6(11)8(13)10(15)9(14)7(5)12/h3H2,1-2H3 |
| InChIKey | DLIFNTQMBOCKTL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|