C10H14N2O2 — CID 6026599
(E)-N,N'-bis(prop-2-enyl)but-2-enediamide (PubChem CID 6026599) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (E)-N,N'-bis(prop-2-enyl)but-2-enediamide.
| Compound Name | (E)-N,N'-bis(prop-2-enyl)but-2-enediamide |
|---|---|
| PubChem CID | 6026599 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (E)-N,N'-bis(prop-2-enyl)but-2-enediamide |
| SMILES | C=CCNC(=O)/C=C/C(=O)NCC=C |
| InChI | InChI=1S/C10H14N2O2/c1-3-7-11-9(13)5-6-10(14)12-8-4-2/h3-6H,1-2,7-8H2,(H,11,13)(H,12,14)/b6-5+ |
| InChIKey | VSMGIASVTLWTLP-AATRIKPKSA-N |
| XLogP | 0.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|