C33H34N2O7 — CID 6026940
[4-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-2-yl]phenyl] 4-methoxybenzoate (PubChem CID 6026940) has the molecular formula C33H34N2O7 and a molecular weight of 570.64 g/mol. Its IUPAC name is [4-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-2-yl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-2-yl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 6026940 |
| Molecular Formula | C33H34N2O7 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | [4-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-2-yl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C3/C(=C(\O)c4ccc(C)cc4)C(=O)C(=O)N3CCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C33H34N2O7/c1-22-4-6-24(7-5-22)30(36)28-29(35(32(38)31(28)37)17-3-16-34-18-20-41-21-19-34)23-8-14-27(15-9-23)42-33(39)25-10-12-26(40-2)13-11-25/h4-15,29,36H,3,16-21H2,1-2H3/b30-28+ |
| InChIKey | STPMLPGZDYDZGS-SJCQXOIGSA-N |
| XLogP | 4.37 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|