C5H10O5 — CID 6027
(2S,3R,4S,5R)-oxane-2,3,4,5-tetrol (PubChem CID 6027) has the molecular formula C5H10O5 and a molecular weight of 150.13 g/mol. Its IUPAC name is (2S,3R,4S,5R)-oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R)-oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 6027 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | (2S,3R,4S,5R)-oxane-2,3,4,5-tetrol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](O)OC[C@H]1O |
| InChI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5+/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-LECHCGJUSA-N |
| XLogP | -2.58 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |