C15H20O4 — CID 602760
2,5-dihydroxy-3-methyl-6-(6-methylhept-5-en-2-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 602760) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2,5-dihydroxy-3-methyl-6-(6-methylhept-5-en-2-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3-methyl-6-(6-methylhept-5-en-2-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 602760 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2,5-dihydroxy-3-methyl-6-(6-methylhept-5-en-2-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=CCCC(C)C1=C(O)C(=O)C(C)=C(O)C1=O |
| InChI | InChI=1S/C15H20O4/c1-8(2)6-5-7-9(3)11-14(18)12(16)10(4)13(17)15(11)19/h6,9,16,19H,5,7H2,1-4H3 |
| InChIKey | QBLNXRHAHZPPDO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|