C9H3F9 — CID 602796
1,2,7,7,8,8-hexafluoro-5-(trifluoromethyl)bicyclo[2.2.2]octa-2,5-diene (PubChem CID 602796) has the molecular formula C9H3F9 and a molecular weight of 282.11 g/mol. Its IUPAC name is 1,2,7,7,8,8-hexafluoro-5-(trifluoromethyl)bicyclo[2.2.2]octa-2,5-diene.
| Compound Name | 1,2,7,7,8,8-hexafluoro-5-(trifluoromethyl)bicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 602796 |
| Molecular Formula | C9H3F9 |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 1,2,7,7,8,8-hexafluoro-5-(trifluoromethyl)bicyclo[2.2.2]octa-2,5-diene |
| SMILES | FC1=CC2C(C(F)(F)F)=CC1(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C9H3F9/c10-5-1-3-4(8(14,15)16)2-6(5,11)9(17,18)7(3,12)13/h1-3H |
| InChIKey | OYNJOBHOBVFMGY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|