About 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine
8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine (PubChem CID 6028446) has the molecular formula C22H17N3O5
and a molecular weight of 403.39 g/mol. Its IUPAC name is 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine.
Molecular Properties
| Compound Name | 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine |
| PubChem CID | 6028446 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine |
| SMILES | Cc1ccc2c(c1)N(C/C=C/c1ccccc1)c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])O2 |
| InChI | InChI=1S/C22H17N3O5/c1-15-9-10-20-18(12-15)23(11-5-8-16-6-3-2-4-7-16)22-19(25(28)29)13-17(24(26)27)14-21(22)30-20/h2-10,12-14H,11H2,1H3/b8-5+ |
| InChIKey | ADRXAFCGXMKQML-VMPITWQZSA-N |
| XLogP | 5.77 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine?
The IUPAC name of 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine (CID 6028446) is 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine.
What is the SMILES notation for 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine?
The canonical SMILES for 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine is Cc1ccc2c(c1)N(C/C=C/c1ccccc1)c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])O2.
What is the InChIKey of 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine?
The InChIKey is ADRXAFCGXMKQML-VMPITWQZSA-N. The full InChI is InChI=1S/C22H17N3O5/c1-15-9-10-20-18(12-15)23(11-5-8-16-6-3-2-4-7-16)22-19(25(28)29)13-17(24(26)27)14-21(22)30-20/h2-10,12-14H,11H2,1H3/b8-5+.
What are the key properties of 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine?
8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine has a molecular weight of 403.39 g/mol, XLogP of 5.77, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,3-dinitro-10-[(E)-3-phenylprop-2-enyl]phenoxazine is sourced from PubChem (CID 6028446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).