C21H16ClN3O4 — CID 6029635
N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 6029635) has the molecular formula C21H16ClN3O4 and a molecular weight of 409.83 g/mol. Its IUPAC name is N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 6029635 |
| Molecular Formula | C21H16ClN3O4 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | O=C(N/N=C\c1cccc(OCc2ccc(Cl)cc2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16ClN3O4/c22-18-9-7-15(8-10-18)14-29-20-6-1-3-16(11-20)13-23-24-21(26)17-4-2-5-19(12-17)25(27)28/h1-13H,14H2,(H,24,26)/b23-13- |
| InChIKey | QNXWDIAWVBOSNL-QRVIBDJDSA-N |
| XLogP | 4.59 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|