About 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol
1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol (PubChem CID 602976) has the molecular formula C16H20N2O2S
and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol |
| PubChem CID | 602976 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol |
| SMILES | Cc1cc(C)nc(SCC(O)COCc2ccccc2)n1 |
| InChI | InChI=1S/C16H20N2O2S/c1-12-8-13(2)18-16(17-12)21-11-15(19)10-20-9-14-6-4-3-5-7-14/h3-8,15,19H,9-11H2,1-2H3 |
| InChIKey | YMVYDDKAGHZYLM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol?
The IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol (CID 602976) is 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol.
What is the SMILES notation for 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol?
The canonical SMILES for 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol is Cc1cc(C)nc(SCC(O)COCc2ccccc2)n1.
What is the InChIKey of 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol?
The InChIKey is YMVYDDKAGHZYLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2S/c1-12-8-13(2)18-16(17-12)21-11-15(19)10-20-9-14-6-4-3-5-7-14/h3-8,15,19H,9-11H2,1-2H3.
What are the key properties of 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol?
1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol has a molecular weight of 304.42 g/mol, XLogP of 2.76, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-phenylmethoxypropan-2-ol is sourced from PubChem (CID 602976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).