About (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine
(2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine (PubChem CID 6030481) has the molecular formula C7H8Cl3N3O2
and a molecular weight of 272.52 g/mol. Its IUPAC name is (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine.
Molecular Properties
| Compound Name | (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine |
| PubChem CID | 6030481 |
| Molecular Formula | C7H8Cl3N3O2 |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine |
| SMILES | CN1CCN/C1=C(\C(Cl)=C(Cl)Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C7H8Cl3N3O2/c1-12-3-2-11-7(12)5(13(14)15)4(8)6(9)10/h11H,2-3H2,1H3/b7-5- |
| InChIKey | ASTAOQLBUXWNNV-ALCCZGGFSA-N |
| XLogP | 1.85 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine?
The IUPAC name of (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine (CID 6030481) is (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine.
What is the SMILES notation for (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine?
The canonical SMILES for (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine is CN1CCN/C1=C(\C(Cl)=C(Cl)Cl)[N+](=O)[O-].
What is the InChIKey of (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine?
The InChIKey is ASTAOQLBUXWNNV-ALCCZGGFSA-N. The full InChI is InChI=1S/C7H8Cl3N3O2/c1-12-3-2-11-7(12)5(13(14)15)4(8)6(9)10/h11H,2-3H2,1H3/b7-5-.
What are the key properties of (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine?
(2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine has a molecular weight of 272.52 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1-methyl-2-(2,3,3-trichloro-1-nitroprop-2-enylidene)imidazolidine is sourced from PubChem (CID 6030481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).