About (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol
(3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol (PubChem CID 603049) has the molecular formula C8H9NO2S
and a molecular weight of 183.23 g/mol. Its IUPAC name is (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol.
Molecular Properties
| Compound Name | (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol |
| PubChem CID | 603049 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol |
| SMILES | OCC1CC(c2cccs2)=NO1 |
| InChI | InChI=1S/C8H9NO2S/c10-5-6-4-7(9-11-6)8-2-1-3-12-8/h1-3,6,10H,4-5H2 |
| InChIKey | IJAQFIXXAFUKGP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol?
The IUPAC name of (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol (CID 603049) is (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol.
What is the SMILES notation for (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol?
The canonical SMILES for (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol is OCC1CC(c2cccs2)=NO1.
What is the InChIKey of (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol?
The InChIKey is IJAQFIXXAFUKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S/c10-5-6-4-7(9-11-6)8-2-1-3-12-8/h1-3,6,10H,4-5H2.
What are the key properties of (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol?
(3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol has a molecular weight of 183.23 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-thiophen-2-yl-4,5-dihydro-1,2-oxazol-5-yl)methanol is sourced from PubChem (CID 603049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).