About benzyl 2-bromobenzoate
benzyl 2-bromobenzoate (PubChem CID 603174) has the molecular formula C14H11BrO2
and a molecular weight of 291.14 g/mol. Its IUPAC name is benzyl 2-bromobenzoate.
Molecular Properties
| Compound Name | benzyl 2-bromobenzoate |
| PubChem CID | 603174 |
| Molecular Formula | C14H11BrO2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | benzyl 2-bromobenzoate |
| SMILES | O=C(OCc1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C14H11BrO2/c15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | DUPARWHGHLJSTB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-bromobenzoate?
The IUPAC name of benzyl 2-bromobenzoate (CID 603174) is benzyl 2-bromobenzoate.
What is the SMILES notation for benzyl 2-bromobenzoate?
The canonical SMILES for benzyl 2-bromobenzoate is O=C(OCc1ccccc1)c1ccccc1Br.
What is the InChIKey of benzyl 2-bromobenzoate?
The InChIKey is DUPARWHGHLJSTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrO2/c15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-9H,10H2.
What are the key properties of benzyl 2-bromobenzoate?
benzyl 2-bromobenzoate has a molecular weight of 291.14 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-bromobenzoate is sourced from PubChem (CID 603174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).