About 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid
3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid (PubChem CID 6034415) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid |
| PubChem CID | 6034415 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid |
| SMILES | O=C(O)CCc1ccc2c(c1)/C(=N/O)CC2 |
| InChI | InChI=1S/C12H13NO3/c14-12(15)6-2-8-1-3-9-4-5-11(13-16)10(9)7-8/h1,3,7,16H,2,4-6H2,(H,14,15)/b13-11+ |
| InChIKey | WLOBXHMMWIACON-ACCUITESSA-N |
| XLogP | 1.83 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid?
The IUPAC name of 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid (CID 6034415) is 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid.
What is the SMILES notation for 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid?
The canonical SMILES for 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid is O=C(O)CCc1ccc2c(c1)/C(=N/O)CC2.
What is the InChIKey of 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid?
The InChIKey is WLOBXHMMWIACON-ACCUITESSA-N. The full InChI is InChI=1S/C12H13NO3/c14-12(15)6-2-8-1-3-9-4-5-11(13-16)10(9)7-8/h1,3,7,16H,2,4-6H2,(H,14,15)/b13-11+.
What are the key properties of 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid?
3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid has a molecular weight of 219.24 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl]propanoic acid is sourced from PubChem (CID 6034415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).