C24H26ClN3OS2 — CID 6035533
(5Z)-3-butyl-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 6035533) has the molecular formula C24H26ClN3OS2 and a molecular weight of 472.08 g/mol. Its IUPAC name is (5Z)-3-butyl-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-butyl-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6035533 |
| Molecular Formula | C24H26ClN3OS2 |
| Molecular Weight | 472.08 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | (5Z)-3-butyl-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)/C(=C2/Sc3ccc(Cl)cc3N2CC)S/C1=N\c1ccc(C)cc1C |
| InChI | InChI=1S/C24H26ClN3OS2/c1-5-7-12-28-22(29)21(31-24(28)26-18-10-8-15(3)13-16(18)4)23-27(6-2)19-14-17(25)9-11-20(19)30-23/h8-11,13-14H,5-7,12H2,1-4H3/b23-21-,26-24- |
| InChIKey | KQHVDGJRZNKMGJ-NPGCFZLRSA-N |
| XLogP | 7.12 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.08 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|