C13H13ClN4OS2 — CID 6035573
N'-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 6035573) has the molecular formula C13H13ClN4OS2 and a molecular weight of 340.86 g/mol. Its IUPAC name is N'-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 6035573 |
| Molecular Formula | C13H13ClN4OS2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | N'-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nnc(SCC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H13ClN4OS2/c1-18(2)8-15-12-16-17-13(21-12)20-7-11(19)9-3-5-10(14)6-4-9/h3-6,8H,7H2,1-2H3/b15-8+ |
| InChIKey | VUIHBQXFTGTDHI-OVCLIPMQSA-N |
| XLogP | 3.39 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|