C36H37N5O4S — CID 6035987
2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 6035987) has the molecular formula C36H37N5O4S and a molecular weight of 635.79 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6035987 |
| Molecular Formula | C36H37N5O4S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)N/N=C\c3ccc(OC)c(OCc4ccccc4)c3)nnc2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H37N5O4S/c1-36(2,3)28-14-12-27(13-15-28)34-39-40-35(41(34)29-16-18-30(43-4)19-17-29)46-24-33(42)38-37-22-26-11-20-31(44-5)32(21-26)45-23-25-9-7-6-8-10-25/h6-22H,23-24H2,1-5H3,(H,38,42)/b37-22- |
| InChIKey | MTUYULWYLPENNU-GKVNEZTPSA-N |
| XLogP | 7.07 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|