About N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine
N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine (PubChem CID 603637) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine |
| PubChem CID | 603637 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine |
| SMILES | Cc1nc2ccccc2nc(C)c1=NO |
| InChI | InChI=1S/C11H11N3O/c1-7-11(14-15)8(2)13-10-6-4-3-5-9(10)12-7/h3-6,15H,1-2H3 |
| InChIKey | QDZRKMVGVOWFHT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine?
The IUPAC name of N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine (CID 603637) is N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine.
What is the SMILES notation for N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine?
The canonical SMILES for N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine is Cc1nc2ccccc2nc(C)c1=NO.
What is the InChIKey of N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine?
The InChIKey is QDZRKMVGVOWFHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O/c1-7-11(14-15)8(2)13-10-6-4-3-5-9(10)12-7/h3-6,15H,1-2H3.
What are the key properties of N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine?
N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine has a molecular weight of 201.23 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dimethyl-1,5-benzodiazepin-3-ylidene)hydroxylamine is sourced from PubChem (CID 603637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).