C30H33N5O7 — CID 6036751
[(7E)-3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone (PubChem CID 6036751) has the molecular formula C30H33N5O7 and a molecular weight of 575.62 g/mol. Its IUPAC name is [(7E)-3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone.
| Compound Name | [(7E)-3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 6036751 |
| Molecular Formula | C30H33N5O7 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | [(7E)-3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone |
| SMILES | CCn1cc([N+](=O)[O-])c(C(=O)N2N=C3/C(=C/c4ccc(OC)c(OC)c4)CCCC3C2c2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C30H33N5O7/c1-6-33-17-22(35(37)38)28(31-33)30(36)34-29(20-11-13-24(40-3)26(16-20)42-5)21-9-7-8-19(27(21)32-34)14-18-10-12-23(39-2)25(15-18)41-4/h10-17,21,29H,6-9H2,1-5H3/b19-14+ |
| InChIKey | PCAMQWSSCWUNDY-XMHGGMMESA-N |
| XLogP | 5.28 |
| TPSA | 130.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|