C26H22ClN5OS — CID 6039931
(6Z)-2-[(4-chlorophenyl)methyl]-6-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6039931) has the molecular formula C26H22ClN5OS and a molecular weight of 488.02 g/mol. Its IUPAC name is (6Z)-2-[(4-chlorophenyl)methyl]-6-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-2-[(4-chlorophenyl)methyl]-6-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6039931 |
| Molecular Formula | C26H22ClN5OS |
| Molecular Weight | 488.02 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | (6Z)-2-[(4-chlorophenyl)methyl]-6-[[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cc(C)n(-c3ccccc3C)c2C)/C(=O)N=C2SC(Cc3ccc(Cl)cc3)=NN2/1 |
| InChI | InChI=1S/C26H22ClN5OS/c1-15-6-4-5-7-22(15)31-16(2)12-19(17(31)3)14-21-24(28)32-26(29-25(21)33)34-23(30-32)13-18-8-10-20(27)11-9-18/h4-12,14,28H,13H2,1-3H3/b21-14-,28-24- |
| InChIKey | SCDSMBDPXAUUKV-JTCIKWTMSA-N |
| XLogP | 5.92 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.02 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|