About 2,5-dimethoxythieno[3,2-b]thiophene
2,5-dimethoxythieno[3,2-b]thiophene (PubChem CID 603996) has the molecular formula C8H8O2S2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2,5-dimethoxythieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 2,5-dimethoxythieno[3,2-b]thiophene |
| PubChem CID | 603996 |
| Molecular Formula | C8H8O2S2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 2,5-dimethoxythieno[3,2-b]thiophene |
| SMILES | COc1cc2sc(OC)cc2s1 |
| InChI | InChI=1S/C8H8O2S2/c1-9-7-3-5-6(11-7)4-8(10-2)12-5/h3-4H,1-2H3 |
| InChIKey | HORNALLIXJLRAA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethoxythieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxythieno[3,2-b]thiophene?
The IUPAC name of 2,5-dimethoxythieno[3,2-b]thiophene (CID 603996) is 2,5-dimethoxythieno[3,2-b]thiophene.
What is the SMILES notation for 2,5-dimethoxythieno[3,2-b]thiophene?
The canonical SMILES for 2,5-dimethoxythieno[3,2-b]thiophene is COc1cc2sc(OC)cc2s1.
What is the InChIKey of 2,5-dimethoxythieno[3,2-b]thiophene?
The InChIKey is HORNALLIXJLRAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S2/c1-9-7-3-5-6(11-7)4-8(10-2)12-5/h3-4H,1-2H3.
What are the key properties of 2,5-dimethoxythieno[3,2-b]thiophene?
2,5-dimethoxythieno[3,2-b]thiophene has a molecular weight of 200.28 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxythieno[3,2-b]thiophene is sourced from PubChem (CID 603996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).