C14H19NO2 — CID 6040
1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidine (PubChem CID 6040) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidine |
|---|---|
| PubChem CID | 6040 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidine |
| SMILES | c1ccc2c(c1)OCC(CN1CCCCC1)O2 |
| InChI | InChI=1S/C14H19NO2/c1-4-8-15(9-5-1)10-12-11-16-13-6-2-3-7-14(13)17-12/h2-3,6-7,12H,1,4-5,8-11H2 |
| InChIKey | LYKMMUBOEFYJQG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |