C12H12N4O2 — CID 604092
14,14-dimethyl-10,13-dioxa-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 604092) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 14,14-dimethyl-10,13-dioxa-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 14,14-dimethyl-10,13-dioxa-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 604092 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 14,14-dimethyl-10,13-dioxa-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CC1(C)Cc2c(oc3ncn4ncnc4c23)CO1 |
| InChI | InChI=1S/C12H12N4O2/c1-12(2)3-7-8(4-17-12)18-11-9(7)10-13-5-15-16(10)6-14-11/h5-6H,3-4H2,1-2H3 |
| InChIKey | WATHKVHQPJDHRE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |