About (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine
(2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine (PubChem CID 6041231) has the molecular formula C6H5BrCl2N2O3
and a molecular weight of 303.93 g/mol. Its IUPAC name is (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine |
| PubChem CID | 6041231 |
| Molecular Formula | C6H5BrCl2N2O3 |
| Molecular Weight | 303.93 g/mol |
| Exact Mass | 301.89 |
| IUPAC Name | (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine |
| SMILES | O=[N+]([O-])C(/C(Cl)=C(\Cl)Br)=C1\NCCO1 |
| InChI | InChI=1S/C6H5BrCl2N2O3/c7-5(9)3(8)4(11(12)13)6-10-1-2-14-6/h10H,1-2H2/b5-3+,6-4+ |
| InChIKey | TVDQXVCJIOTCJX-GGWOSOGESA-N |
| XLogP | 2.09 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.93 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine?
The IUPAC name of (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine (CID 6041231) is (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine.
What is the SMILES notation for (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine?
The canonical SMILES for (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine is O=[N+]([O-])C(/C(Cl)=C(\Cl)Br)=C1\NCCO1.
What is the InChIKey of (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine?
The InChIKey is TVDQXVCJIOTCJX-GGWOSOGESA-N. The full InChI is InChI=1S/C6H5BrCl2N2O3/c7-5(9)3(8)4(11(12)13)6-10-1-2-14-6/h10H,1-2H2/b5-3+,6-4+.
What are the key properties of (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine?
(2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine has a molecular weight of 303.93 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(Z)-3-bromo-2,3-dichloro-1-nitroprop-2-enylidene]-1,3-oxazolidine is sourced from PubChem (CID 6041231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).