C20H23NO2S — CID 604128
2,2,4,6-tetramethyl-1-(4-methylphenyl)sulfonylquinoline (PubChem CID 604128) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 2,2,4,6-tetramethyl-1-(4-methylphenyl)sulfonylquinoline.
| Compound Name | 2,2,4,6-tetramethyl-1-(4-methylphenyl)sulfonylquinoline |
|---|---|
| PubChem CID | 604128 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2,2,4,6-tetramethyl-1-(4-methylphenyl)sulfonylquinoline |
| SMILES | CC1=CC(C)(C)N(S(=O)(=O)c2ccc(C)cc2)c2ccc(C)cc21 |
| InChI | InChI=1S/C20H23NO2S/c1-14-6-9-17(10-7-14)24(22,23)21-19-11-8-15(2)12-18(19)16(3)13-20(21,4)5/h6-13H,1-5H3 |
| InChIKey | LZJDHKWIGJESRE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |