C23H14N4O4S — CID 6041554
2-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzo[f]chromen-3-one (PubChem CID 6041554) has the molecular formula C23H14N4O4S and a molecular weight of 442.46 g/mol. Its IUPAC name is 2-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzo[f]chromen-3-one.
| Compound Name | 2-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 6041554 |
| Molecular Formula | C23H14N4O4S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 2-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzo[f]chromen-3-one |
| SMILES | O=c1oc2ccc3ccccc3c2cc1-c1cnc(N/N=C\c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C23H14N4O4S/c28-22-19(11-18-17-4-2-1-3-15(17)7-10-20(18)31-22)21-13-24-23(32-21)26-25-12-14-5-8-16(9-6-14)27(29)30/h1-13H,(H,24,26)/b25-12- |
| InChIKey | SYVISQYMONQDKO-ROTLSHHCSA-N |
| XLogP | 5.42 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|