C26H27O5P — CID 604263
8-diphenylphosphanyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 604263) has the molecular formula C26H27O5P and a molecular weight of 450.47 g/mol. Its IUPAC name is 8-diphenylphosphanyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | 8-diphenylphosphanyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 604263 |
| Molecular Formula | C26H27O5P |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 8-diphenylphosphanyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | COC1OC2COC(c3ccccc3)OC2C(P(c2ccccc2)c2ccccc2)C1O |
| InChI | InChI=1S/C26H27O5P/c1-28-26-22(27)24(32(19-13-7-3-8-14-19)20-15-9-4-10-16-20)23-21(30-26)17-29-25(31-23)18-11-5-2-6-12-18/h2-16,21-27H,17H2,1H3 |
| InChIKey | SENXSNNRXBZMCF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|