C22H23N7O3 — CID 6043335
2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-(4-methylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 6043335) has the molecular formula C22H23N7O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-(4-methylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-(4-methylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6043335 |
| Molecular Formula | C22H23N7O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-(4-methylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N/N=C\c3ccc4c(c3)OCO4)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C22H23N7O3/c1-15-2-5-17(6-3-15)24-20-25-21(27-22(26-20)29-8-10-30-11-9-29)28-23-13-16-4-7-18-19(12-16)32-14-31-18/h2-7,12-13H,8-11,14H2,1H3,(H2,24,25,26,27,28)/b23-13- |
| InChIKey | UIJMDUXHELIQBM-QRVIBDJDSA-N |
| XLogP | 2.93 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|