About 4-pyridin-4-ylbenzene-1,2-diol
4-pyridin-4-ylbenzene-1,2-diol (PubChem CID 604349) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-pyridin-4-ylbenzene-1,2-diol.
Molecular Properties
| Compound Name | 4-pyridin-4-ylbenzene-1,2-diol |
| PubChem CID | 604349 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 4-pyridin-4-ylbenzene-1,2-diol |
| SMILES | Oc1ccc(-c2ccncc2)cc1O |
| InChI | InChI=1S/C11H9NO2/c13-10-2-1-9(7-11(10)14)8-3-5-12-6-4-8/h1-7,13-14H |
| InChIKey | GQRZBBQWBHAPOX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-pyridin-4-ylbenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-ylbenzene-1,2-diol?
The IUPAC name of 4-pyridin-4-ylbenzene-1,2-diol (CID 604349) is 4-pyridin-4-ylbenzene-1,2-diol.
What is the SMILES notation for 4-pyridin-4-ylbenzene-1,2-diol?
The canonical SMILES for 4-pyridin-4-ylbenzene-1,2-diol is Oc1ccc(-c2ccncc2)cc1O.
What is the InChIKey of 4-pyridin-4-ylbenzene-1,2-diol?
The InChIKey is GQRZBBQWBHAPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-10-2-1-9(7-11(10)14)8-3-5-12-6-4-8/h1-7,13-14H.
What are the key properties of 4-pyridin-4-ylbenzene-1,2-diol?
4-pyridin-4-ylbenzene-1,2-diol has a molecular weight of 187.20 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-ylbenzene-1,2-diol is sourced from PubChem (CID 604349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).