About 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine
1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine (PubChem CID 604376) has the molecular formula C17H25Cl2FN2
and a molecular weight of 347.31 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine.
Molecular Properties
| Compound Name | 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine |
| PubChem CID | 604376 |
| Molecular Formula | C17H25Cl2FN2 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine |
| SMILES | FCCCCCN1CCN(CCc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25Cl2FN2/c18-16-5-4-15(14-17(16)19)6-9-22-12-10-21(11-13-22)8-3-1-2-7-20/h4-5,14H,1-3,6-13H2 |
| InChIKey | RTZAOYPTRNELOX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine?
The IUPAC name of 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine (CID 604376) is 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine.
What is the SMILES notation for 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine?
The canonical SMILES for 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine is FCCCCCN1CCN(CCc2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine?
The InChIKey is RTZAOYPTRNELOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25Cl2FN2/c18-16-5-4-15(14-17(16)19)6-9-22-12-10-21(11-13-22)8-3-1-2-7-20/h4-5,14H,1-3,6-13H2.
What are the key properties of 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine?
1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine has a molecular weight of 347.31 g/mol, XLogP of 4.29, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-dichlorophenyl)ethyl]-4-(5-fluoropentyl)piperazine is sourced from PubChem (CID 604376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).