C16H11NO5S — CID 6043867
3-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 6043867) has the molecular formula C16H11NO5S and a molecular weight of 329.33 g/mol. Its IUPAC name is 3-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-methylbenzoic acid.
| Compound Name | 3-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 6043867 |
| Molecular Formula | C16H11NO5S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1-c1ccc(/C=C2\SC(=O)NC2=O)o1 |
| InChI | InChI=1S/C16H11NO5S/c1-8-10(3-2-4-11(8)15(19)20)12-6-5-9(22-12)7-13-14(18)17-16(21)23-13/h2-7H,1H3,(H,19,20)(H,17,18,21)/b13-7- |
| InChIKey | QDSSPOBUWOXOBT-QPEQYQDCSA-N |
| XLogP | 3.28 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|