C18H17N5O3 — CID 604520
N-[2-(2,3-dihydro-[1,4]oxazino[3,2-b]quinoxalin-4-yl)ethyl]-4-nitroaniline (PubChem CID 604520) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-[1,4]oxazino[3,2-b]quinoxalin-4-yl)ethyl]-4-nitroaniline.
| Compound Name | N-[2-(2,3-dihydro-[1,4]oxazino[3,2-b]quinoxalin-4-yl)ethyl]-4-nitroaniline |
|---|---|
| PubChem CID | 604520 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[2-(2,3-dihydro-[1,4]oxazino[3,2-b]quinoxalin-4-yl)ethyl]-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(NCCN2CCOc3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C18H17N5O3/c24-23(25)14-7-5-13(6-8-14)19-9-10-22-11-12-26-18-17(22)20-15-3-1-2-4-16(15)21-18/h1-8,19H,9-12H2 |
| InChIKey | DDOGPNRYQMCWLT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|