C11H17N3O — CID 6045203
[(Z)-(2,6,6-trimethylcyclohepta-2,4-dien-1-ylidene)amino]urea (PubChem CID 6045203) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is [(Z)-(2,6,6-trimethylcyclohepta-2,4-dien-1-ylidene)amino]urea.
| Compound Name | [(Z)-(2,6,6-trimethylcyclohepta-2,4-dien-1-ylidene)amino]urea |
|---|---|
| PubChem CID | 6045203 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | [(Z)-(2,6,6-trimethylcyclohepta-2,4-dien-1-ylidene)amino]urea |
| SMILES | CC1=CC=CC(C)(C)C/C1=N/NC(N)=O |
| InChI | InChI=1S/C11H17N3O/c1-8-5-4-6-11(2,3)7-9(8)13-14-10(12)15/h4-6H,7H2,1-3H3,(H3,12,14,15)/b13-9- |
| InChIKey | MEJLUZDQBYIVSR-LCYFTJDESA-N |
| XLogP | 1.94 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|