C8H22Si3 — CID 604552
1,1,3,3,5-pentamethyl-1,3,5-trisilinane (PubChem CID 604552) has the molecular formula C8H22Si3 and a molecular weight of 202.52 g/mol. Its IUPAC name is 1,1,3,3,5-pentamethyl-1,3,5-trisilinane.
| Compound Name | 1,1,3,3,5-pentamethyl-1,3,5-trisilinane |
|---|---|
| PubChem CID | 604552 |
| Molecular Formula | C8H22Si3 |
| Molecular Weight | 202.52 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1,1,3,3,5-pentamethyl-1,3,5-trisilinane |
| SMILES | C[SiH]1C[Si](C)(C)C[Si](C)(C)C1 |
| InChI | InChI=1S/C8H22Si3/c1-9-6-10(2,3)8-11(4,5)7-9/h9H,6-8H2,1-5H3 |
| InChIKey | FDBLCTDNVYXBCP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|