About [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate
[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 6046631) has the molecular formula C18H18FNO3
and a molecular weight of 315.34 g/mol. Its IUPAC name is [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| PubChem CID | 6046631 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)/C=C/c2ccc(F)cc2)c(C)n1C |
| InChI | InChI=1S/C18H18FNO3/c1-12-10-16(13(2)20(12)3)17(21)11-23-18(22)9-6-14-4-7-15(19)8-5-14/h4-10H,11H2,1-3H3/b9-6+ |
| InChIKey | OREMULXHBQDEJP-RMKNXTFCSA-N |
| XLogP | 3.22 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate?
The IUPAC name of [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (CID 6046631) is [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
What is the SMILES notation for [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate?
The canonical SMILES for [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate is Cc1cc(C(=O)COC(=O)/C=C/c2ccc(F)cc2)c(C)n1C.
What is the InChIKey of [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate?
The InChIKey is OREMULXHBQDEJP-RMKNXTFCSA-N. The full InChI is InChI=1S/C18H18FNO3/c1-12-10-16(13(2)20(12)3)17(21)11-23-18(22)9-6-14-4-7-15(19)8-5-14/h4-10H,11H2,1-3H3/b9-6+.
What are the key properties of [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate?
[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate has a molecular weight of 315.34 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate is sourced from PubChem (CID 6046631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).