C18H15N3O2S — CID 604704
1-[4-(1H-benzimidazol-2-ylsulfanylmethyl)phenyl]pyrrolidine-2,5-dione (PubChem CID 604704) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-ylsulfanylmethyl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-(1H-benzimidazol-2-ylsulfanylmethyl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 604704 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-ylsulfanylmethyl)phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1ccc(CSc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C18H15N3O2S/c22-16-9-10-17(23)21(16)13-7-5-12(6-8-13)11-24-18-19-14-3-1-2-4-15(14)20-18/h1-8H,9-11H2,(H,19,20) |
| InChIKey | GPLAIZANQYKUPM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|