C17H16F2N4O — CID 6047801
(E)-3-[2-(difluoromethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 6047801) has the molecular formula C17H16F2N4O and a molecular weight of 330.34 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6047801 |
| Molecular Formula | C17H16F2N4O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1OC(F)F)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C17H16F2N4O/c18-17(19)24-14-7-4-3-6-12(14)10-13(11-20)16-22-21-15-8-2-1-5-9-23(15)16/h3-4,6-7,10,17H,1-2,5,8-9H2/b13-10+ |
| InChIKey | YXGNQIWFFRWNJY-JLHYYAGUSA-N |
| XLogP | 3.67 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|