About 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid
5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 604898) has the molecular formula C8H12O6
and a molecular weight of 204.18 g/mol. Its IUPAC name is 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| PubChem CID | 604898 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | COC(=O)C1OC(C)(C)OC1C(=O)O |
| InChI | InChI=1S/C8H12O6/c1-8(2)13-4(6(9)10)5(14-8)7(11)12-3/h4-5H,1-3H3,(H,9,10) |
| InChIKey | QDCLIEXYHDLWGC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (CID 604898) is 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid is COC(=O)C1OC(C)(C)OC1C(=O)O.
What is the InChIKey of 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid?
The InChIKey is QDCLIEXYHDLWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O6/c1-8(2)13-4(6(9)10)5(14-8)7(11)12-3/h4-5H,1-3H3,(H,9,10).
What are the key properties of 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid?
5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid has a molecular weight of 204.18 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 604898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).