C19H13F3N2O3S2 — CID 6049312
4-methoxy-N-[(5Z)-4-oxo-2-sulfanylidene-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-3-yl]benzamide (PubChem CID 6049312) has the molecular formula C19H13F3N2O3S2 and a molecular weight of 438.45 g/mol. Its IUPAC name is 4-methoxy-N-[(5Z)-4-oxo-2-sulfanylidene-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-methoxy-N-[(5Z)-4-oxo-2-sulfanylidene-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 6049312 |
| Molecular Formula | C19H13F3N2O3S2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 4-methoxy-N-[(5Z)-4-oxo-2-sulfanylidene-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)NN2C(=O)/C(=C/c3ccc(C(F)(F)F)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C19H13F3N2O3S2/c1-27-14-8-4-12(5-9-14)16(25)23-24-17(26)15(29-18(24)28)10-11-2-6-13(7-3-11)19(20,21)22/h2-10H,1H3,(H,23,25)/b15-10- |
| InChIKey | PGFPWIUDDZBOCP-GDNBJRDFSA-N |
| XLogP | 4.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|